Methyl 3H-pyrazolo[3 - Names and Identifiers
Name | methyl 3H-pyrazolo[3,4-c]pyridine-5-carboxylate
|
Synonyms | Methyl 3H-pyrazolo[3 Methyl 3H-pyrazolo[3,4-c]pyridine-5-carboxylate methyl 3H-pyrazolo[3,4-c]pyridine-5-carboxylate 3H-Pyrazolo[3,4-c]pyridine-5-carboxylic acid, Methyl ester 3H-Pyrazolo[3,4-c]pyridine-5-carboxylic acid, methyl ester
|
CAS | 868552-25-4
|
InChI | InChI=1S/C8H7N3O2/c1-13-8(12)6-2-5-3-10-11-7(5)4-9-6/h2,4H,3H2,1H3 |
Methyl 3H-pyrazolo[3 - Physico-chemical Properties
Molecular Formula | C8H7N3O2
|
Molar Mass | 177.16 |
Methyl 3H-pyrazolo[3 - Introduction
methyl 3H-pyrazolo[3,4-c]pyridine-5-carboxylate is an organic compound with the chemical formula C10H7N3O2. Its nature is as follows:
1. appearance: methyl 3H-pyrazolo[3,4-c]pyridine-5-carboxylate is a solid, common is white to light yellow crystalline powder.
2. Solubility: It can be dissolved in solvents such as dimethyl sulfoxide (DMSO) and dichloromethane (CH2Cl2).
3. use: methyl 3H-pyrazolo[3,4-c]pyridine-5-carboxylate is often used as an intermediate in organic synthesis, mainly for the synthesis of biologically active compounds, such as drugs, pesticides and other organic molecules.
4. preparation method: methyl 3H-pyrazolo[3,4-c]pyridine-5-carboxylate has many preparation methods, the most common one is obtained by the reaction of pyrazole and dimethyl pentanedioate (dimethyl glutarate) under suitable conditions.
5. safety information: when using and handling methyl 3H-pyrazolo[3,4-c]pyridine-5-carboxylate, you need to pay attention to the following safety matters:
-It should be used in a well-ventilated area, avoiding inhalation, touching the skin or entering the eyes.
-Wear appropriate personal protective equipment, such as lab gloves and goggles.
-Avoid contact with chemicals such as oxidants or strong acids to avoid dangerous reactions.
-In case of accidental contact with skin or eyes, rinse immediately with water and seek medical help.
Last Update:2024-04-09 19:05:52